C15H19N3O3 — CID 117467462
3-(4-methoxy-3-piperidin-3-yloxyphenyl)-1,2-oxazol-5-amine (PubChem CID 117467462) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 3-(4-methoxy-3-piperidin-3-yloxyphenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-(4-methoxy-3-piperidin-3-yloxyphenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117467462 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 3-(4-methoxy-3-piperidin-3-yloxyphenyl)-1,2-oxazol-5-amine |
| SMILES | COc1ccc(-c2cc(N)on2)cc1OC1CCCNC1 |
| InChI | InChI=1S/C15H19N3O3/c1-19-13-5-4-10(12-8-15(16)21-18-12)7-14(13)20-11-3-2-6-17-9-11/h4-5,7-8,11,17H,2-3,6,9,16H2,1H3 |
| InChIKey | JAGXCGDXRVAAJY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 82.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |