C25H22ClN3O5 — CID 16605634
(E)-1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine (PubChem CID 16605634) has the molecular formula C25H22ClN3O5 and a molecular weight of 479.92 g/mol. Its IUPAC name is (E)-1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine.
| Compound Name | (E)-1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 16605634 |
| Molecular Formula | C25H22ClN3O5 |
| Molecular Weight | 479.92 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (E)-1-[4-[(4-chlorophenyl)methoxy]-3-methoxyphenyl]-N-[[5-(4-methoxyphenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine |
| SMILES | COc1ccc(-c2nnc(CO/N=C/c3ccc(OCc4ccc(Cl)cc4)c(OC)c3)o2)cc1 |
| InChI | InChI=1S/C25H22ClN3O5/c1-30-21-10-6-19(7-11-21)25-29-28-24(34-25)16-33-27-14-18-5-12-22(23(13-18)31-2)32-15-17-3-8-20(26)9-4-17/h3-14H,15-16H2,1-2H3/b27-14+ |
| InChIKey | PJXBOBLYAKMXNG-MZJWZYIUSA-N |
| XLogP | 5.54 |
| TPSA | 88.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.92 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|