C16H11BrClN3O2 — CID 7702211
(Z)-1-(4-bromophenyl)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine (PubChem CID 7702211) has the molecular formula C16H11BrClN3O2 and a molecular weight of 392.64 g/mol. Its IUPAC name is (Z)-1-(4-bromophenyl)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine.
| Compound Name | (Z)-1-(4-bromophenyl)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine |
|---|---|
| PubChem CID | 7702211 |
| Molecular Formula | C16H11BrClN3O2 |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 390.97 |
| IUPAC Name | (Z)-1-(4-bromophenyl)-N-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxy]methanimine |
| SMILES | Clc1ccc(-c2nnc(CO/N=C\c3ccc(Br)cc3)o2)cc1 |
| InChI | InChI=1S/C16H11BrClN3O2/c17-13-5-1-11(2-6-13)9-19-22-10-15-20-21-16(23-15)12-3-7-14(18)8-4-12/h1-9H,10H2/b19-9- |
| InChIKey | MSLVKDFIRAUYCC-OCKHKDLRSA-N |
| XLogP | 4.70 |
| TPSA | 60.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|