C18H16ClN3O2 — CID 10712295
(E)-1-(4-chlorophenyl)-N-[2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethoxy]methanimine (PubChem CID 10712295) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-N-[2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethoxy]methanimine.
| Compound Name | (E)-1-(4-chlorophenyl)-N-[2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethoxy]methanimine |
|---|---|
| PubChem CID | 10712295 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-N-[2-[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]ethoxy]methanimine |
| SMILES | Cc1ccc(-c2nnc(CCO/N=C/c3ccc(Cl)cc3)o2)cc1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-13-2-6-15(7-3-13)18-22-21-17(24-18)10-11-23-20-12-14-4-8-16(19)9-5-14/h2-9,12H,10-11H2,1H3/b20-12+ |
| InChIKey | YJPKTSBVVRNXON-UDWIEESQSA-N |
| XLogP | 4.29 |
| TPSA | 60.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|