C11H12ClN2O4P — CID 176515688
2-(4-chlorophenyl)-5-(dimethoxyphosphorylmethyl)-1,3,4-oxadiazole (PubChem CID 176515688) has the molecular formula C11H12ClN2O4P and a molecular weight of 302.65 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5-(dimethoxyphosphorylmethyl)-1,3,4-oxadiazole.
| Compound Name | 2-(4-chlorophenyl)-5-(dimethoxyphosphorylmethyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 176515688 |
| Molecular Formula | C11H12ClN2O4P |
| Molecular Weight | 302.65 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 2-(4-chlorophenyl)-5-(dimethoxyphosphorylmethyl)-1,3,4-oxadiazole |
| SMILES | COP(=O)(Cc1nnc(-c2ccc(Cl)cc2)o1)OC |
| InChI | InChI=1S/C11H12ClN2O4P/c1-16-19(15,17-2)7-10-13-14-11(18-10)8-3-5-9(12)6-4-8/h3-6H,7H2,1-2H3 |
| InChIKey | RQTCSNXGQNFRPS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|