C15H21N2O4P — CID 176515717
2-[di(propan-2-yloxy)phosphorylmethyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 176515717) has the molecular formula C15H21N2O4P and a molecular weight of 324.32 g/mol. Its IUPAC name is 2-[di(propan-2-yloxy)phosphorylmethyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[di(propan-2-yloxy)phosphorylmethyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 176515717 |
| Molecular Formula | C15H21N2O4P |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 2-[di(propan-2-yloxy)phosphorylmethyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | CC(C)OP(=O)(Cc1nnc(-c2ccccc2)o1)OC(C)C |
| InChI | InChI=1S/C15H21N2O4P/c1-11(2)20-22(18,21-12(3)4)10-14-16-17-15(19-14)13-8-6-5-7-9-13/h5-9,11-12H,10H2,1-4H3 |
| InChIKey | AKNVOXKJJCMULB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 74.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|