C12H16N2OS — CID 178170665
ethane;2-(methylsulfanylmethyl)-5-phenyl-1,3,4-oxadiazole (PubChem CID 178170665) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is ethane;2-(methylsulfanylmethyl)-5-phenyl-1,3,4-oxadiazole.
| Compound Name | ethane;2-(methylsulfanylmethyl)-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 178170665 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | ethane;2-(methylsulfanylmethyl)-5-phenyl-1,3,4-oxadiazole |
| SMILES | CC.CSCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C10H10N2OS.C2H6/c1-14-7-9-11-12-10(13-9)8-5-3-2-4-6-8;1-2/h2-6H,7H2,1H3;1-2H3 |
| InChIKey | QTVRHMSCTUVPMS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |