C15H13N3OS — CID 79133881
3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]aniline (PubChem CID 79133881) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is 3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]aniline.
| Compound Name | 3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]aniline |
|---|---|
| PubChem CID | 79133881 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-[(5-phenyl-1,3,4-oxadiazol-2-yl)methylsulfanyl]aniline |
| SMILES | Nc1cccc(SCc2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C15H13N3OS/c16-12-7-4-8-13(9-12)20-10-14-17-18-15(19-14)11-5-2-1-3-6-11/h1-9H,10,16H2 |
| InChIKey | YBJGPONAKGXYHZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|