C12H6ClN5O2 — CID 155067944
2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]propanedinitrile (PubChem CID 155067944) has the molecular formula C12H6ClN5O2 and a molecular weight of 287.67 g/mol. Its IUPAC name is 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]propanedinitrile.
| Compound Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]propanedinitrile |
|---|---|
| PubChem CID | 155067944 |
| Molecular Formula | C12H6ClN5O2 |
| Molecular Weight | 287.67 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]methoxyimino]propanedinitrile |
| SMILES | N#CC(C#N)=NOCc1nnc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C12H6ClN5O2/c13-9-3-1-8(2-4-9)12-17-16-11(20-12)7-19-18-10(5-14)6-15/h1-4H,7H2 |
| InChIKey | ABVIKUPWFRQPLM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 108.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.67 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|