C12H7N5O2 — CID 155067987
2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxyimino]propanedinitrile (PubChem CID 155067987) has the molecular formula C12H7N5O2 and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxyimino]propanedinitrile.
| Compound Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxyimino]propanedinitrile |
|---|---|
| PubChem CID | 155067987 |
| Molecular Formula | C12H7N5O2 |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.06 |
| IUPAC Name | 2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methoxyimino]propanedinitrile |
| SMILES | N#CC(C#N)=NOCc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H7N5O2/c13-6-10(7-14)17-18-8-11-15-16-12(19-11)9-4-2-1-3-5-9/h1-5H,8H2 |
| InChIKey | CCMBNYPAEOVRNN-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 108.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|