C17H15BrN4O2 — CID 95045003
N'-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylethanimidamide (PubChem CID 95045003) has the molecular formula C17H15BrN4O2 and a molecular weight of 387.24 g/mol. Its IUPAC name is N'-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylethanimidamide.
| Compound Name | N'-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylethanimidamide |
|---|---|
| PubChem CID | 95045003 |
| Molecular Formula | C17H15BrN4O2 |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | N'-[[5-(3-bromophenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylethanimidamide |
| SMILES | N/C(Cc1ccccc1)=N\OCc1nnc(-c2cccc(Br)c2)o1 |
| InChI | InChI=1S/C17H15BrN4O2/c18-14-8-4-7-13(10-14)17-21-20-16(24-17)11-23-22-15(19)9-12-5-2-1-3-6-12/h1-8,10H,9,11H2,(H2,19,22) |
| InChIKey | OAYJUORGHBIWBN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|