C24H22N4O3 — CID 56502457
N'-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylmethoxybenzenecarboximidamide (PubChem CID 56502457) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is N'-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylmethoxybenzenecarboximidamide.
| Compound Name | N'-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylmethoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 56502457 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | N'-[[5-(4-methylphenyl)-1,3,4-oxadiazol-2-yl]methoxy]-2-phenylmethoxybenzenecarboximidamide |
| SMILES | Cc1ccc(-c2nnc(CO/N=C(/N)c3ccccc3OCc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C24H22N4O3/c1-17-11-13-19(14-12-17)24-27-26-22(31-24)16-30-28-23(25)20-9-5-6-10-21(20)29-15-18-7-3-2-4-8-18/h2-14H,15-16H2,1H3,(H2,25,28) |
| InChIKey | AGCYCPNXECTKNG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|