C9H8N2O3S — CID 174726453
(5-phenyl-1,3,4-oxadiazol-2-yl)methanesulfinic acid (PubChem CID 174726453) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methanesulfinic acid.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methanesulfinic acid |
|---|---|
| PubChem CID | 174726453 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methanesulfinic acid |
| SMILES | O=S(O)Cc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C9H8N2O3S/c12-15(13)6-8-10-11-9(14-8)7-4-2-1-3-5-7/h1-5H,6H2,(H,12,13) |
| InChIKey | WQHJKQBMLZUQBT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|