C13H15N3O4S — CID 167851989
5-(3-methylsulfonylphenyl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 167851989) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 5-(3-methylsulfonylphenyl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(3-methylsulfonylphenyl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 167851989 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 5-(3-methylsulfonylphenyl)-N-(oxolan-3-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | CS(=O)(=O)c1cccc(-c2nnc(NC3CCOC3)o2)c1 |
| InChI | InChI=1S/C13H15N3O4S/c1-21(17,18)11-4-2-3-9(7-11)12-15-16-13(20-12)14-10-5-6-19-8-10/h2-4,7,10H,5-6,8H2,1H3,(H,14,16) |
| InChIKey | PMGSALITOVWDAM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |