C12H15FO3S — CID 115048234
2-[1-(1,1-dioxothiolan-3-yl)-1-fluoroethyl]phenol (PubChem CID 115048234) has the molecular formula C12H15FO3S and a molecular weight of 258.31 g/mol. Its IUPAC name is 2-[1-(1,1-dioxothiolan-3-yl)-1-fluoroethyl]phenol.
| Compound Name | 2-[1-(1,1-dioxothiolan-3-yl)-1-fluoroethyl]phenol |
|---|---|
| PubChem CID | 115048234 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 2-[1-(1,1-dioxothiolan-3-yl)-1-fluoroethyl]phenol |
| SMILES | CC(F)(c1ccccc1O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H15FO3S/c1-12(13,9-6-7-17(15,16)8-9)10-4-2-3-5-11(10)14/h2-5,9,14H,6-8H2,1H3 |
| InChIKey | VMWZZEQUGHCWHV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |