About 1-fluoro-4-methylbenzene;methylcyclobutane;toluene
1-fluoro-4-methylbenzene;methylcyclobutane;toluene (PubChem CID 145168505) has the molecular formula C19H25F
and a molecular weight of 272.41 g/mol. Its IUPAC name is 1-fluoro-4-methylbenzene;methylcyclobutane;toluene.
Molecular Properties
| Compound Name | 1-fluoro-4-methylbenzene;methylcyclobutane;toluene |
| PubChem CID | 145168505 |
| Molecular Formula | C19H25F |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-fluoro-4-methylbenzene;methylcyclobutane;toluene |
| SMILES | CC1CCC1.Cc1ccc(F)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C7H7F.C7H8.C5H10/c1-6-2-4-7(8)5-3-6;1-7-5-3-2-4-6-7;1-5-3-2-4-5/h2-5H,1H3;2-6H,1H3;5H,2-4H2,1H3 |
| InChIKey | AJVZGDUXMVRFIT-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-fluoro-4-methylbenzene;methylcyclobutane;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-4-methylbenzene;methylcyclobutane;toluene?
The IUPAC name of 1-fluoro-4-methylbenzene;methylcyclobutane;toluene (CID 145168505) is 1-fluoro-4-methylbenzene;methylcyclobutane;toluene.
What is the SMILES notation for 1-fluoro-4-methylbenzene;methylcyclobutane;toluene?
The canonical SMILES for 1-fluoro-4-methylbenzene;methylcyclobutane;toluene is CC1CCC1.Cc1ccc(F)cc1.Cc1ccccc1.
What is the InChIKey of 1-fluoro-4-methylbenzene;methylcyclobutane;toluene?
The InChIKey is AJVZGDUXMVRFIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7F.C7H8.C5H10/c1-6-2-4-7(8)5-3-6;1-7-5-3-2-4-6-7;1-5-3-2-4-5/h2-5H,1H3;2-6H,1H3;5H,2-4H2,1H3.
What are the key properties of 1-fluoro-4-methylbenzene;methylcyclobutane;toluene?
1-fluoro-4-methylbenzene;methylcyclobutane;toluene has a molecular weight of 272.41 g/mol, XLogP of 5.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-4-methylbenzene;methylcyclobutane;toluene is sourced from PubChem (CID 145168505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).