C6H13NO4S — CID 43827459
(1,1-dioxothiolan-3-yl)azanium acetate (PubChem CID 43827459) has the molecular formula C6H13NO4S and a molecular weight of 195.24 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)azanium acetate.
| Compound Name | (1,1-dioxothiolan-3-yl)azanium acetate |
|---|---|
| PubChem CID | 43827459 |
| Molecular Formula | C6H13NO4S |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)azanium acetate |
| SMILES | CC(=O)[O-].[NH3+]C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C4H9NO2S.C2H4O2/c5-4-1-2-8(6,7)3-4;1-2(3)4/h4H,1-3,5H2;1H3,(H,3,4) |
| InChIKey | SGIBICULZDGTTN-UHFFFAOYSA-N |
| XLogP | -2.83 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | -2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |