C10H20N2O2S — CID 62133246
1-[(1,1-dioxothiolan-3-yl)methyl]piperidin-4-amine (PubChem CID 62133246) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]piperidin-4-amine.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 62133246 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]piperidin-4-amine |
| SMILES | NC1CCN(CC2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C10H20N2O2S/c11-10-1-4-12(5-2-10)7-9-3-6-15(13,14)8-9/h9-10H,1-8,11H2 |
| InChIKey | OBVBOQPMKHVDIV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |