C9H18N2O2S — CID 43511755
N-(1,1-dioxothiolan-3-yl)piperidin-4-amine (PubChem CID 43511755) has the molecular formula C9H18N2O2S and a molecular weight of 218.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)piperidin-4-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)piperidin-4-amine |
|---|---|
| PubChem CID | 43511755 |
| Molecular Formula | C9H18N2O2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)piperidin-4-amine |
| SMILES | O=S1(=O)CCC(NC2CCNCC2)C1 |
| InChI | InChI=1S/C9H18N2O2S/c12-14(13)6-3-9(7-14)11-8-1-4-10-5-2-8/h8-11H,1-7H2 |
| InChIKey | WITUPXDSKABGCX-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |