C8H15NO3S2 — CID 66219017
2,3,4,5a,6,8,9,9a-octahydro-1H-thiopyrano[3,4-b][1,4]thiazepine 5,7,7-trioxide (PubChem CID 66219017) has the molecular formula C8H15NO3S2 and a molecular weight of 237.35 g/mol. Its IUPAC name is 2,3,4,5a,6,8,9,9a-octahydro-1H-thiopyrano[3,4-b][1,4]thiazepine 5,7,7-trioxide.
| Compound Name | 2,3,4,5a,6,8,9,9a-octahydro-1H-thiopyrano[3,4-b][1,4]thiazepine 5,7,7-trioxide |
|---|---|
| PubChem CID | 66219017 |
| Molecular Formula | C8H15NO3S2 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 2,3,4,5a,6,8,9,9a-octahydro-1H-thiopyrano[3,4-b][1,4]thiazepine 5,7,7-trioxide |
| SMILES | O=S1CCCNC2CCS(=O)(=O)CC21 |
| InChI | InChI=1S/C8H15NO3S2/c10-13-4-1-3-9-7-2-5-14(11,12)6-8(7)13/h7-9H,1-6H2 |
| InChIKey | IQWVMZUSFPNJSP-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |