C16H30N2O2S — CID 79541542
1,1-dioxo-N-(2-piperidin-2-ylcyclohexyl)thian-3-amine (PubChem CID 79541542) has the molecular formula C16H30N2O2S and a molecular weight of 314.50 g/mol. Its IUPAC name is 1,1-dioxo-N-(2-piperidin-2-ylcyclohexyl)thian-3-amine.
| Compound Name | 1,1-dioxo-N-(2-piperidin-2-ylcyclohexyl)thian-3-amine |
|---|---|
| PubChem CID | 79541542 |
| Molecular Formula | C16H30N2O2S |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1,1-dioxo-N-(2-piperidin-2-ylcyclohexyl)thian-3-amine |
| SMILES | O=S1(=O)CCCC(NC2CCCCC2C2CCCCN2)C1 |
| InChI | InChI=1S/C16H30N2O2S/c19-21(20)11-5-6-13(12-21)18-16-9-2-1-7-14(16)15-8-3-4-10-17-15/h13-18H,1-12H2 |
| InChIKey | JGXWKHYRXAOQLT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.50 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |