C13H22N2O2S — CID 63923529
2-[(1,1-dioxothian-3-yl)amino]cycloheptane-1-carbonitrile (PubChem CID 63923529) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 2-[(1,1-dioxothian-3-yl)amino]cycloheptane-1-carbonitrile.
| Compound Name | 2-[(1,1-dioxothian-3-yl)amino]cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 63923529 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[(1,1-dioxothian-3-yl)amino]cycloheptane-1-carbonitrile |
| SMILES | N#CC1CCCCCC1NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H22N2O2S/c14-9-11-5-2-1-3-7-13(11)15-12-6-4-8-18(16,17)10-12/h11-13,15H,1-8,10H2 |
| InChIKey | RPUNAOUXULEPKR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |