C12H20N2O2S — CID 62743497
2-[(1,1-dioxothiolan-3-yl)amino]cycloheptane-1-carbonitrile (PubChem CID 62743497) has the molecular formula C12H20N2O2S and a molecular weight of 256.37 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)amino]cycloheptane-1-carbonitrile.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)amino]cycloheptane-1-carbonitrile |
|---|---|
| PubChem CID | 62743497 |
| Molecular Formula | C12H20N2O2S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)amino]cycloheptane-1-carbonitrile |
| SMILES | N#CC1CCCCCC1NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20N2O2S/c13-8-10-4-2-1-3-5-12(10)14-11-6-7-17(15,16)9-11/h10-12,14H,1-7,9H2 |
| InChIKey | UHDZXAPTAQIBHF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |