C9H17NO3S — CID 130610256
trans-(1R,2R)-2-[(1,1-dioxothian-3-yl)amino]cyclobutan-1-ol (PubChem CID 130610256) has the molecular formula C9H17NO3S and a molecular weight of 219.31 g/mol. Its IUPAC name is trans-(1R,2R)-2-[(1,1-dioxothian-3-yl)amino]cyclobutan-1-ol.
| Compound Name | trans-(1R,2R)-2-[(1,1-dioxothian-3-yl)amino]cyclobutan-1-ol |
|---|---|
| PubChem CID | 130610256 |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | trans-(1R,2R)-2-[(1,1-dioxothian-3-yl)amino]cyclobutan-1-ol |
| SMILES | O=S1(=O)CCCC(N[C@@H]2CC[C@H]2O)C1 |
| InChI | InChI=1S/C9H17NO3S/c11-9-4-3-8(9)10-7-2-1-5-14(12,13)6-7/h7-11H,1-6H2/t7?,8-,9-/m1/s1 |
| InChIKey | DVSQNJNNEZIDAI-CFCGPWAMSA-N |
| XLogP | -0.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |