C13H21N3O2S — CID 63921817
N-(2-imidazol-1-ylcyclopentyl)-1,1-dioxothian-3-amine (PubChem CID 63921817) has the molecular formula C13H21N3O2S and a molecular weight of 283.40 g/mol. Its IUPAC name is N-(2-imidazol-1-ylcyclopentyl)-1,1-dioxothian-3-amine.
| Compound Name | N-(2-imidazol-1-ylcyclopentyl)-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 63921817 |
| Molecular Formula | C13H21N3O2S |
| Molecular Weight | 283.40 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-(2-imidazol-1-ylcyclopentyl)-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NC2CCCC2n2ccnc2)C1 |
| InChI | InChI=1S/C13H21N3O2S/c17-19(18)8-2-3-11(9-19)15-12-4-1-5-13(12)16-7-6-14-10-16/h6-7,10-13,15H,1-5,8-9H2 |
| InChIKey | QTFGEJRTLVYZQC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |