C10H19NO3S — CID 63923831
N-(1,1-dioxothian-3-yl)oxan-3-amine (PubChem CID 63923831) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)oxan-3-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)oxan-3-amine |
|---|---|
| PubChem CID | 63923831 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)oxan-3-amine |
| SMILES | O=S1(=O)CCCC(NC2CCCOC2)C1 |
| InChI | InChI=1S/C10H19NO3S/c12-15(13)6-2-4-10(8-15)11-9-3-1-5-14-7-9/h9-11H,1-8H2 |
| InChIKey | YWTTZGRYEMRHJO-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |