C12H20F3NO2S — CID 63923212
1,1-dioxo-N-[4-(trifluoromethyl)cyclohexyl]thian-3-amine (PubChem CID 63923212) has the molecular formula C12H20F3NO2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 1,1-dioxo-N-[4-(trifluoromethyl)cyclohexyl]thian-3-amine.
| Compound Name | 1,1-dioxo-N-[4-(trifluoromethyl)cyclohexyl]thian-3-amine |
|---|---|
| PubChem CID | 63923212 |
| Molecular Formula | C12H20F3NO2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1,1-dioxo-N-[4-(trifluoromethyl)cyclohexyl]thian-3-amine |
| SMILES | O=S1(=O)CCCC(NC2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C12H20F3NO2S/c13-12(14,15)9-3-5-10(6-4-9)16-11-2-1-7-19(17,18)8-11/h9-11,16H,1-8H2 |
| InChIKey | KMGODISNZKDKIS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |