C12H19F3N2O3S — CID 114908870
N-(1,1-dioxothian-3-yl)-5-(trifluoromethyl)piperidine-2-carboxamide (PubChem CID 114908870) has the molecular formula C12H19F3N2O3S and a molecular weight of 328.36 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-5-(trifluoromethyl)piperidine-2-carboxamide.
| Compound Name | N-(1,1-dioxothian-3-yl)-5-(trifluoromethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114908870 |
| Molecular Formula | C12H19F3N2O3S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-5-(trifluoromethyl)piperidine-2-carboxamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)C1CCC(C(F)(F)F)CN1 |
| InChI | InChI=1S/C12H19F3N2O3S/c13-12(14,15)8-3-4-10(16-6-8)11(18)17-9-2-1-5-21(19,20)7-9/h8-10,16H,1-7H2,(H,17,18) |
| InChIKey | UDEQIAMFPVGPIM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |