C12H21F3N4O — CID 114908963
N-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)piperidine-2-carboxamide (PubChem CID 114908963) has the molecular formula C12H21F3N4O and a molecular weight of 294.32 g/mol. Its IUPAC name is N-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)piperidine-2-carboxamide.
| Compound Name | N-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 114908963 |
| Molecular Formula | C12H21F3N4O |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | N-(4-methylpiperazin-1-yl)-5-(trifluoromethyl)piperidine-2-carboxamide |
| SMILES | CN1CCN(NC(=O)C2CCC(C(F)(F)F)CN2)CC1 |
| InChI | InChI=1S/C12H21F3N4O/c1-18-4-6-19(7-5-18)17-11(20)10-3-2-9(8-16-10)12(13,14)15/h9-10,16H,2-8H2,1H3,(H,17,20) |
| InChIKey | GLSBCELHNTVZHX-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |