C11H23N5O — CID 83016765
5-methyl-N-(4-methylpiperazin-1-yl)piperazine-2-carboxamide (PubChem CID 83016765) has the molecular formula C11H23N5O and a molecular weight of 241.34 g/mol. Its IUPAC name is 5-methyl-N-(4-methylpiperazin-1-yl)piperazine-2-carboxamide.
| Compound Name | 5-methyl-N-(4-methylpiperazin-1-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 83016765 |
| Molecular Formula | C11H23N5O |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.19 |
| IUPAC Name | 5-methyl-N-(4-methylpiperazin-1-yl)piperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)NN2CCN(C)CC2)CN1 |
| InChI | InChI=1S/C11H23N5O/c1-9-7-13-10(8-12-9)11(17)14-16-5-3-15(2)4-6-16/h9-10,12-13H,3-8H2,1-2H3,(H,14,17) |
| InChIKey | CRANSIAUWACINO-UHFFFAOYSA-N |
| XLogP | -1.79 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |