C8H16N4O2 — CID 63102938
N-(2-amino-2-oxoethyl)-5-methylpiperazine-2-carboxamide (PubChem CID 63102938) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-5-methylpiperazine-2-carboxamide.
| Compound Name | N-(2-amino-2-oxoethyl)-5-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 63102938 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-5-methylpiperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)NCC(N)=O)CN1 |
| InChI | InChI=1S/C8H16N4O2/c1-5-2-11-6(3-10-5)8(14)12-4-7(9)13/h5-6,10-11H,2-4H2,1H3,(H2,9,13)(H,12,14) |
| InChIKey | UYPBHVUJRCAIRS-UHFFFAOYSA-N |
| XLogP | -2.46 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |