C11H21N3O3S — CID 63102388
N-(1,1-dioxothian-4-yl)-5-methylpiperazine-2-carboxamide (PubChem CID 63102388) has the molecular formula C11H21N3O3S and a molecular weight of 275.37 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-5-methylpiperazine-2-carboxamide.
| Compound Name | N-(1,1-dioxothian-4-yl)-5-methylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 63102388 |
| Molecular Formula | C11H21N3O3S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-5-methylpiperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)NC2CCS(=O)(=O)CC2)CN1 |
| InChI | InChI=1S/C11H21N3O3S/c1-8-6-13-10(7-12-8)11(15)14-9-2-4-18(16,17)5-3-9/h8-10,12-13H,2-7H2,1H3,(H,14,15) |
| InChIKey | VNRQUGQVIKDIOQ-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |