C11H19NO4S — CID 165455343
5-(1,1-dioxothian-3-yl)piperidine-2-carboxylic acid (PubChem CID 165455343) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is 5-(1,1-dioxothian-3-yl)piperidine-2-carboxylic acid.
| Compound Name | 5-(1,1-dioxothian-3-yl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 165455343 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 5-(1,1-dioxothian-3-yl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(C2CCCS(=O)(=O)C2)CN1 |
| InChI | InChI=1S/C11H19NO4S/c13-11(14)10-4-3-8(6-12-10)9-2-1-5-17(15,16)7-9/h8-10,12H,1-7H2,(H,13,14) |
| InChIKey | DNYYCKVZBHPIJU-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |