C13H24N2O4S — CID 63924279
tert-butyl 3-[(1,1-dioxothian-3-yl)amino]azetidine-1-carboxylate (PubChem CID 63924279) has the molecular formula C13H24N2O4S and a molecular weight of 304.41 g/mol. Its IUPAC name is tert-butyl 3-[(1,1-dioxothian-3-yl)amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(1,1-dioxothian-3-yl)amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 63924279 |
| Molecular Formula | C13H24N2O4S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | tert-butyl 3-[(1,1-dioxothian-3-yl)amino]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(NC2CCCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C13H24N2O4S/c1-13(2,3)19-12(16)15-7-11(8-15)14-10-5-4-6-20(17,18)9-10/h10-11,14H,4-9H2,1-3H3 |
| InChIKey | IGIMZSXFBNBMGD-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |