C11H21NO2S — CID 104517922
2-(azepan-2-yl)thiane 1,1-dioxide (PubChem CID 104517922) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 2-(azepan-2-yl)thiane 1,1-dioxide.
| Compound Name | 2-(azepan-2-yl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 104517922 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 2-(azepan-2-yl)thiane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCC1C1CCCCCN1 |
| InChI | InChI=1S/C11H21NO2S/c13-15(14)9-5-3-7-11(15)10-6-2-1-4-8-12-10/h10-12H,1-9H2 |
| InChIKey | OMKZJFJUABZGOF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |