About 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide
10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide (PubChem CID 66224686) has the molecular formula C12H23NOS
and a molecular weight of 229.39 g/mol. Its IUPAC name is 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide.
Molecular Properties
| Compound Name | 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide |
| PubChem CID | 66224686 |
| Molecular Formula | C12H23NOS |
| Molecular Weight | 229.39 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide |
| SMILES | CC1CCNC2CCCCCCC2S1=O |
| InChI | InChI=1S/C12H23NOS/c1-10-8-9-13-11-6-4-2-3-5-7-12(11)15(10)14/h10-13H,2-9H2,1H3 |
| InChIKey | LHJFMQMZJSDZQX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide?
The IUPAC name of 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide (CID 66224686) is 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide.
What is the SMILES notation for 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide?
The canonical SMILES for 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide is CC1CCNC2CCCCCCC2S1=O.
What is the InChIKey of 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide?
The InChIKey is LHJFMQMZJSDZQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NOS/c1-10-8-9-13-11-6-4-2-3-5-7-12(11)15(10)14/h10-13H,2-9H2,1H3.
What are the key properties of 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide?
10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide has a molecular weight of 229.39 g/mol, XLogP of 2.21, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methyl-9λ4-thia-13-azabicyclo[6.5.0]tridecane 9-oxide is sourced from PubChem (CID 66224686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).