C14H24N4O2 — CID 102319648
(3S,6S)-3,6-bis[(2R)-piperidin-2-yl]piperazine-2,5-dione (PubChem CID 102319648) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is (3S,6S)-3,6-bis[(2R)-piperidin-2-yl]piperazine-2,5-dione.
| Compound Name | (3S,6S)-3,6-bis[(2R)-piperidin-2-yl]piperazine-2,5-dione |
|---|---|
| PubChem CID | 102319648 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (3S,6S)-3,6-bis[(2R)-piperidin-2-yl]piperazine-2,5-dione |
| SMILES | O=C1N[C@@H]([C@H]2CCCCN2)C(=O)N[C@H]1[C@H]1CCCCN1 |
| InChI | InChI=1S/C14H24N4O2/c19-13-11(9-5-1-3-7-15-9)17-14(20)12(18-13)10-6-2-4-8-16-10/h9-12,15-16H,1-8H2,(H,17,20)(H,18,19)/t9-,10-,11+,12+/m1/s1 |
| InChIKey | BYRFZQHJSFCZIV-WYUUTHIRSA-N |
| XLogP | -0.75 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |