C7H14OS — CID 54262172
2,6-dimethylthiane 1-oxide (PubChem CID 54262172) has the molecular formula C7H14OS and a molecular weight of 146.25 g/mol. Its IUPAC name is 2,6-dimethylthiane 1-oxide.
| Compound Name | 2,6-dimethylthiane 1-oxide |
|---|---|
| PubChem CID | 54262172 |
| Molecular Formula | C7H14OS |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2,6-dimethylthiane 1-oxide |
| SMILES | CC1CCCC(C)S1=O |
| InChI | InChI=1S/C7H14OS/c1-6-4-3-5-7(2)9(6)8/h6-7H,3-5H2,1-2H3 |
| InChIKey | CHAIOOYSIWITFG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |