About 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide
3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide (PubChem CID 171950992) has the molecular formula C10H18OS
and a molecular weight of 186.32 g/mol. Its IUPAC name is 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide.
Molecular Properties
| Compound Name | 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide |
| PubChem CID | 171950992 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide |
| SMILES | CCC1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C10H18OS/c1-2-8-6-9-4-3-5-10(7-8)12(9)11/h8-10H,2-7H2,1H3 |
| InChIKey | IKUFWGNMHHLQQX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide?
The IUPAC name of 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide (CID 171950992) is 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide.
What is the SMILES notation for 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide?
The canonical SMILES for 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide is CCC1CC2CCCC(C1)S2=O.
What is the InChIKey of 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide?
The InChIKey is IKUFWGNMHHLQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18OS/c1-2-8-6-9-4-3-5-10(7-8)12(9)11/h8-10H,2-7H2,1H3.
What are the key properties of 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide?
3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide has a molecular weight of 186.32 g/mol, XLogP of 2.48, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-9λ4-thiabicyclo[3.3.1]nonane 9-oxide is sourced from PubChem (CID 171950992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).