C14H22O2S — CID 171938636
4-methyl-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pent-3-en-1-one (PubChem CID 171938636) has the molecular formula C14H22O2S and a molecular weight of 254.39 g/mol. Its IUPAC name is 4-methyl-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pent-3-en-1-one.
| Compound Name | 4-methyl-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pent-3-en-1-one |
|---|---|
| PubChem CID | 171938636 |
| Molecular Formula | C14H22O2S |
| Molecular Weight | 254.39 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 4-methyl-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)pent-3-en-1-one |
| SMILES | CC(C)=CCC(=O)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C14H22O2S/c1-10(2)6-7-14(15)11-8-12-4-3-5-13(9-11)17(12)16/h6,11-13H,3-5,7-9H2,1-2H3 |
| InChIKey | GNADEJRWCOQENN-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|