About (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol
(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol (PubChem CID 171937331) has the molecular formula C9H16OS2
and a molecular weight of 204.36 g/mol. Its IUPAC name is (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol.
Molecular Properties
| Compound Name | (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol |
| PubChem CID | 171937331 |
| Molecular Formula | C9H16OS2 |
| Molecular Weight | 204.36 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol |
| SMILES | O=S1C2CCCC1CC(CS)C2 |
| InChI | InChI=1S/C9H16OS2/c10-12-8-2-1-3-9(12)5-7(4-8)6-11/h7-9,11H,1-6H2 |
| InChIKey | WEEUAZMETWVVCL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol?
The IUPAC name of (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol (CID 171937331) is (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol.
What is the SMILES notation for (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol?
The canonical SMILES for (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol is O=S1C2CCCC1CC(CS)C2.
What is the InChIKey of (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol?
The InChIKey is WEEUAZMETWVVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16OS2/c10-12-8-2-1-3-9(12)5-7(4-8)6-11/h7-9,11H,1-6H2.
What are the key properties of (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol?
(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol has a molecular weight of 204.36 g/mol, XLogP of 2.00, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)methanethiol is sourced from PubChem (CID 171937331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).