About 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one
1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one (PubChem CID 171950099) has the molecular formula C16H28O2S
and a molecular weight of 284.46 g/mol. Its IUPAC name is 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one.
Molecular Properties
| Compound Name | 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one |
| PubChem CID | 171950099 |
| Molecular Formula | C16H28O2S |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one |
| SMILES | CCCCCCCC(=O)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C16H28O2S/c1-2-3-4-5-6-10-16(17)13-11-14-8-7-9-15(12-13)19(14)18/h13-15H,2-12H2,1H3 |
| InChIKey | VLDVKGNNZMCKKU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one?
The IUPAC name of 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one (CID 171950099) is 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one.
What is the SMILES notation for 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one?
The canonical SMILES for 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one is CCCCCCCC(=O)C1CC2CCCC(C1)S2=O.
What is the InChIKey of 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one?
The InChIKey is VLDVKGNNZMCKKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2S/c1-2-3-4-5-6-10-16(17)13-11-14-8-7-9-15(12-13)19(14)18/h13-15H,2-12H2,1H3.
What are the key properties of 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one?
1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one has a molecular weight of 284.46 g/mol, XLogP of 4.00, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)octan-1-one is sourced from PubChem (CID 171950099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).