About 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one
3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one (PubChem CID 171938202) has the molecular formula C12H20O3S
and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one |
| PubChem CID | 171938202 |
| Molecular Formula | C12H20O3S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one |
| SMILES | COCCC(=O)C1CC2CCCC(C1)S2=O |
| InChI | InChI=1S/C12H20O3S/c1-15-6-5-12(13)9-7-10-3-2-4-11(8-9)16(10)14/h9-11H,2-8H2,1H3 |
| InChIKey | YPVAKNYDNDKQDZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one?
The IUPAC name of 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one (CID 171938202) is 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one.
What is the SMILES notation for 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one?
The canonical SMILES for 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one is COCCC(=O)C1CC2CCCC(C1)S2=O.
What is the InChIKey of 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one?
The InChIKey is YPVAKNYDNDKQDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3S/c1-15-6-5-12(13)9-7-10-3-2-4-11(8-9)16(10)14/h9-11H,2-8H2,1H3.
What are the key properties of 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one?
3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one has a molecular weight of 244.36 g/mol, XLogP of 1.67, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-1-(9-oxo-9λ4-thiabicyclo[3.3.1]nonan-3-yl)propan-1-one is sourced from PubChem (CID 171938202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).