methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate

C9H14O3S — CID 171936315

IUPACmethyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate
SMILESCOC(=O)C1CC2CCC(C1)S2=O
InChIInChI=1S/C9H14O3S/c1-12-9(10)6-4-7-2-3-8(5-6)13(7)11/h6-8H,2-5H2,1H3
InChIKeyIQMJNJVQRFOBBR-UHFFFAOYSA-N
MW202.27 g/mol
LogP0.85
Rot. Bonds1

About methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate

methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 171936315) has the molecular formula C9H14O3S and a molecular weight of 202.27 g/mol. Its IUPAC name is methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate.

Molecular Properties

Compound Namemethyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate
PubChem CID171936315
Molecular FormulaC9H14O3S
Molecular Weight202.27 g/mol
Exact Mass202.07
IUPAC Namemethyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate
SMILESCOC(=O)C1CC2CCC(C1)S2=O
InChIInChI=1S/C9H14O3S/c1-12-9(10)6-4-7-2-3-8(5-6)13(7)11/h6-8H,2-5H2,1H3
InChIKeyIQMJNJVQRFOBBR-UHFFFAOYSA-N
XLogP0.85
TPSA43.37 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.27
LogP ≤ 50.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
The IUPAC name of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate (CID 171936315) is methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate.
What is the SMILES notation for methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
The canonical SMILES for methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate is COC(=O)C1CC2CCC(C1)S2=O.
What is the InChIKey of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
The InChIKey is IQMJNJVQRFOBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3S/c1-12-9(10)6-4-7-2-3-8(5-6)13(7)11/h6-8H,2-5H2,1H3.
What are the key properties of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate has a molecular weight of 202.27 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate is sourced from PubChem (CID 171936315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).