About methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate
methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate (PubChem CID 171936315) has the molecular formula C9H14O3S
and a molecular weight of 202.27 g/mol. Its IUPAC name is methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate.
Molecular Properties
| Compound Name | methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate |
| PubChem CID | 171936315 |
| Molecular Formula | C9H14O3S |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate |
| SMILES | COC(=O)C1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C9H14O3S/c1-12-9(10)6-4-7-2-3-8(5-6)13(7)11/h6-8H,2-5H2,1H3 |
| InChIKey | IQMJNJVQRFOBBR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
The IUPAC name of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate (CID 171936315) is methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate.
What is the SMILES notation for methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
The canonical SMILES for methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate is COC(=O)C1CC2CCC(C1)S2=O.
What is the InChIKey of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
The InChIKey is IQMJNJVQRFOBBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3S/c1-12-9(10)6-4-7-2-3-8(5-6)13(7)11/h6-8H,2-5H2,1H3.
What are the key properties of methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate?
methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate has a molecular weight of 202.27 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-oxo-8λ4-thiabicyclo[3.2.1]octane-3-carboxylate is sourced from PubChem (CID 171936315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).