About (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine
(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine (PubChem CID 171937266) has the molecular formula C8H15NOS
and a molecular weight of 173.28 g/mol. Its IUPAC name is (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine.
Molecular Properties
| Compound Name | (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine |
| PubChem CID | 171937266 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine |
| SMILES | NCC1CC2CCC(C1)S2=O |
| InChI | InChI=1S/C8H15NOS/c9-5-6-3-7-1-2-8(4-6)11(7)10/h6-8H,1-5,9H2 |
| InChIKey | CAMPWXZXXLOBFG-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine?
The IUPAC name of (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine (CID 171937266) is (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine.
What is the SMILES notation for (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine?
The canonical SMILES for (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine is NCC1CC2CCC(C1)S2=O.
What is the InChIKey of (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine?
The InChIKey is CAMPWXZXXLOBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NOS/c9-5-6-3-7-1-2-8(4-6)11(7)10/h6-8H,1-5,9H2.
What are the key properties of (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine?
(8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine has a molecular weight of 173.28 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-oxo-8λ4-thiabicyclo[3.2.1]octan-3-yl)methanamine is sourced from PubChem (CID 171937266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).