C14H21NOS — CID 66224916
2,7-dimethyl-3-(4-methylphenyl)-1,4-thiazepane 1-oxide (PubChem CID 66224916) has the molecular formula C14H21NOS and a molecular weight of 251.39 g/mol. Its IUPAC name is 2,7-dimethyl-3-(4-methylphenyl)-1,4-thiazepane 1-oxide.
| Compound Name | 2,7-dimethyl-3-(4-methylphenyl)-1,4-thiazepane 1-oxide |
|---|---|
| PubChem CID | 66224916 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2,7-dimethyl-3-(4-methylphenyl)-1,4-thiazepane 1-oxide |
| SMILES | Cc1ccc(C2NCCC(C)S(=O)C2C)cc1 |
| InChI | InChI=1S/C14H21NOS/c1-10-4-6-13(7-5-10)14-12(3)17(16)11(2)8-9-15-14/h4-7,11-12,14-15H,8-9H2,1-3H3 |
| InChIKey | HWTIYBBDNLWULQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |