C16H23NOS — CID 66227169
4,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5-oxide (PubChem CID 66227169) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 4,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5-oxide.
| Compound Name | 4,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5-oxide |
|---|---|
| PubChem CID | 66227169 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5-oxide |
| SMILES | CC1CCNC2c3ccccc3C(C)(C)CC2S1=O |
| InChI | InChI=1S/C16H23NOS/c1-11-8-9-17-15-12-6-4-5-7-13(12)16(2,3)10-14(15)19(11)18/h4-7,11,14-15,17H,8-10H2,1-3H3 |
| InChIKey | XDURULMANDQVLL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |