(1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid

C12H15NO2 — CID 96722457

IUPAC(1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid
SMILESCC1(C)CN[C@@H](C(=O)O)c2ccccc21
InChIInChI=1S/C12H15NO2/c1-12(2)7-13-10(11(14)15)8-5-3-4-6-9(8)12/h3-6,10,13H,7H2,1-2H3,(H,14,15)/t10-/m1/s1
InChIKeyQWYGXOZYSWNZOV-SNVBAGLBSA-N
MW205.26 g/mol
LogP1.69
Rot. Bonds1

About (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid

(1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid (PubChem CID 96722457) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid.

Molecular Properties

Compound Name(1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid
PubChem CID96722457
Molecular FormulaC12H15NO2
Molecular Weight205.26 g/mol
Exact Mass205.11
IUPAC Name(1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid
SMILESCC1(C)CN[C@@H](C(=O)O)c2ccccc21
InChIInChI=1S/C12H15NO2/c1-12(2)7-13-10(11(14)15)8-5-3-4-6-9(8)12/h3-6,10,13H,7H2,1-2H3,(H,14,15)/t10-/m1/s1
InChIKeyQWYGXOZYSWNZOV-SNVBAGLBSA-N
XLogP1.69
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500205.26
LogP ≤ 51.69
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid?
The IUPAC name of (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid (CID 96722457) is (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid.
What is the SMILES notation for (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid?
The canonical SMILES for (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid is CC1(C)CN[C@@H](C(=O)O)c2ccccc21.
What is the InChIKey of (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid?
The InChIKey is QWYGXOZYSWNZOV-SNVBAGLBSA-N. The full InChI is InChI=1S/C12H15NO2/c1-12(2)7-13-10(11(14)15)8-5-3-4-6-9(8)12/h3-6,10,13H,7H2,1-2H3,(H,14,15)/t10-/m1/s1.
What are the key properties of (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid?
(1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid has a molecular weight of 205.26 g/mol, XLogP of 1.69, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-4,4-dimethyl-2,3-dihydro-1H-isoquinoline-1-carboxylic acid is sourced from PubChem (CID 96722457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).