C16H23NO2S — CID 66226636
3,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5,5-dioxide (PubChem CID 66226636) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is 3,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5,5-dioxide.
| Compound Name | 3,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5,5-dioxide |
|---|---|
| PubChem CID | 66226636 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3,7,7-trimethyl-2,3,4,5a,6,11b-hexahydro-1H-benzo[g][1,5]benzothiazepine 5,5-dioxide |
| SMILES | CC1CNC2c3ccccc3C(C)(C)CC2S(=O)(=O)C1 |
| InChI | InChI=1S/C16H23NO2S/c1-11-9-17-15-12-6-4-5-7-13(12)16(2,3)8-14(15)20(18,19)10-11/h4-7,11,14-15,17H,8-10H2,1-3H3 |
| InChIKey | WZSZLONFPGKBCW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |