C13H17NO3S — CID 66227547
3-methyl-2,3,4,5a,6,11b-hexahydro-1H-chromeno[3,4-b][1,4]thiazepine 5,5-dioxide (PubChem CID 66227547) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 3-methyl-2,3,4,5a,6,11b-hexahydro-1H-chromeno[3,4-b][1,4]thiazepine 5,5-dioxide.
| Compound Name | 3-methyl-2,3,4,5a,6,11b-hexahydro-1H-chromeno[3,4-b][1,4]thiazepine 5,5-dioxide |
|---|---|
| PubChem CID | 66227547 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 3-methyl-2,3,4,5a,6,11b-hexahydro-1H-chromeno[3,4-b][1,4]thiazepine 5,5-dioxide |
| SMILES | CC1CNC2c3ccccc3OCC2S(=O)(=O)C1 |
| InChI | InChI=1S/C13H17NO3S/c1-9-6-14-13-10-4-2-3-5-11(10)17-7-12(13)18(15,16)8-9/h2-5,9,12-14H,6-8H2,1H3 |
| InChIKey | ZFNZXVVLIFBSPH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |